C22H22FN5O3S — CID 46669071
2-[[5-[(2-fluorophenoxy)methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(phenylcarbamoyl)propanamide (PubChem CID 46669071) has the molecular formula C22H22FN5O3S and a molecular weight of 455.52 g/mol. Its IUPAC name is 2-[[5-[(2-fluorophenoxy)methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(phenylcarbamoyl)propanamide.
| Compound Name | 2-[[5-[(2-fluorophenoxy)methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(phenylcarbamoyl)propanamide |
|---|---|
| PubChem CID | 46669071 |
| Molecular Formula | C22H22FN5O3S |
| Molecular Weight | 455.52 g/mol |
| Exact Mass | 455.14 |
| IUPAC Name | 2-[[5-[(2-fluorophenoxy)methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(phenylcarbamoyl)propanamide |
| SMILES | C=CCn1c(COc2ccccc2F)nnc1SC(C)C(=O)NC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C22H22FN5O3S/c1-3-13-28-19(14-31-18-12-8-7-11-17(18)23)26-27-22(28)32-15(2)20(29)25-21(30)24-16-9-5-4-6-10-16/h3-12,15H,1,13-14H2,2H3,(H2,24,25,29,30) |
| InChIKey | KVYAAXAOULQJQS-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 98.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.52 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|