C21H19ClN2O4 — CID 46670271
2-(3-methylphenoxy)ethyl 1-(4-chlorophenyl)-6-methyl-4-oxopyridazine-3-carboxylate (PubChem CID 46670271) has the molecular formula C21H19ClN2O4 and a molecular weight of 398.85 g/mol. Its IUPAC name is 2-(3-methylphenoxy)ethyl 1-(4-chlorophenyl)-6-methyl-4-oxopyridazine-3-carboxylate.
| Compound Name | 2-(3-methylphenoxy)ethyl 1-(4-chlorophenyl)-6-methyl-4-oxopyridazine-3-carboxylate |
|---|---|
| PubChem CID | 46670271 |
| Molecular Formula | C21H19ClN2O4 |
| Molecular Weight | 398.85 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | 2-(3-methylphenoxy)ethyl 1-(4-chlorophenyl)-6-methyl-4-oxopyridazine-3-carboxylate |
| SMILES | Cc1cccc(OCCOC(=O)c2nn(-c3ccc(Cl)cc3)c(C)cc2=O)c1 |
| InChI | InChI=1S/C21H19ClN2O4/c1-14-4-3-5-18(12-14)27-10-11-28-21(26)20-19(25)13-15(2)24(23-20)17-8-6-16(22)7-9-17/h3-9,12-13H,10-11H2,1-2H3 |
| InChIKey | SEFBPSMGYIVWLL-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.85 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|