About 4-[3-(6-methyl-2,4-dioxopyran-3-yl)-3-oxoprop-1-enyl]benzonitrile
4-[3-(6-methyl-2,4-dioxopyran-3-yl)-3-oxoprop-1-enyl]benzonitrile (PubChem CID 4667031) has the molecular formula C16H11NO4
and a molecular weight of 281.27 g/mol. Its IUPAC name is 4-[3-(6-methyl-2,4-dioxopyran-3-yl)-3-oxoprop-1-enyl]benzonitrile.
Molecular Properties
| Compound Name | 4-[3-(6-methyl-2,4-dioxopyran-3-yl)-3-oxoprop-1-enyl]benzonitrile |
| PubChem CID | 4667031 |
| Molecular Formula | C16H11NO4 |
| Molecular Weight | 281.27 g/mol |
| Exact Mass | 281.07 |
| IUPAC Name | 4-[3-(6-methyl-2,4-dioxopyran-3-yl)-3-oxoprop-1-enyl]benzonitrile |
| SMILES | CC1=CC(=O)C(C(=O)C=Cc2ccc(C#N)cc2)C(=O)O1 |
| InChI | InChI=1S/C16H11NO4/c1-10-8-14(19)15(16(20)21-10)13(18)7-6-11-2-4-12(9-17)5-3-11/h2-8,15H,1H3 |
| InChIKey | SQBLVFGEEVSTPI-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 84.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.27 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 4-[3-(6-methyl-2,4-dioxopyran-3-yl)-3-oxoprop-1-enyl]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-(6-methyl-2,4-dioxopyran-3-yl)-3-oxoprop-1-enyl]benzonitrile?
The IUPAC name of 4-[3-(6-methyl-2,4-dioxopyran-3-yl)-3-oxoprop-1-enyl]benzonitrile (CID 4667031) is 4-[3-(6-methyl-2,4-dioxopyran-3-yl)-3-oxoprop-1-enyl]benzonitrile.
What is the SMILES notation for 4-[3-(6-methyl-2,4-dioxopyran-3-yl)-3-oxoprop-1-enyl]benzonitrile?
The canonical SMILES for 4-[3-(6-methyl-2,4-dioxopyran-3-yl)-3-oxoprop-1-enyl]benzonitrile is CC1=CC(=O)C(C(=O)C=Cc2ccc(C#N)cc2)C(=O)O1.
What is the InChIKey of 4-[3-(6-methyl-2,4-dioxopyran-3-yl)-3-oxoprop-1-enyl]benzonitrile?
The InChIKey is SQBLVFGEEVSTPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11NO4/c1-10-8-14(19)15(16(20)21-10)13(18)7-6-11-2-4-12(9-17)5-3-11/h2-8,15H,1H3.
What are the key properties of 4-[3-(6-methyl-2,4-dioxopyran-3-yl)-3-oxoprop-1-enyl]benzonitrile?
4-[3-(6-methyl-2,4-dioxopyran-3-yl)-3-oxoprop-1-enyl]benzonitrile has a molecular weight of 281.27 g/mol, XLogP of 1.79, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-(6-methyl-2,4-dioxopyran-3-yl)-3-oxoprop-1-enyl]benzonitrile is sourced from PubChem (CID 4667031), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).