5-oxoundecanoic acid

C11H20O3 — CID 4667416

IUPAC5-oxoundecanoic acid
SMILESCCCCCCC(=O)CCCC(=O)O
InChIInChI=1S/C11H20O3/c1-2-3-4-5-7-10(12)8-6-9-11(13)14/h2-9H2,1H3,(H,13,14)
InChIKeyLXPXOCHGDNNXCA-UHFFFAOYSA-N
MW200.28 g/mol
LogP2.78
Rot. Bonds9

About 5-oxoundecanoic acid

5-oxoundecanoic acid (PubChem CID 4667416) has the molecular formula C11H20O3 and a molecular weight of 200.28 g/mol. Its IUPAC name is 5-oxoundecanoic acid.

Molecular Properties

Compound Name5-oxoundecanoic acid
PubChem CID4667416
Molecular FormulaC11H20O3
Molecular Weight200.28 g/mol
Exact Mass200.14
IUPAC Name5-oxoundecanoic acid
SMILESCCCCCCC(=O)CCCC(=O)O
InChIInChI=1S/C11H20O3/c1-2-3-4-5-7-10(12)8-6-9-11(13)14/h2-9H2,1H3,(H,13,14)
InChIKeyLXPXOCHGDNNXCA-UHFFFAOYSA-N
XLogP2.78
TPSA54.37 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds9
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500200.28
LogP ≤ 52.78
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 5-oxoundecanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-oxoundecanoic acid?
The IUPAC name of 5-oxoundecanoic acid (CID 4667416) is 5-oxoundecanoic acid.
What is the SMILES notation for 5-oxoundecanoic acid?
The canonical SMILES for 5-oxoundecanoic acid is CCCCCCC(=O)CCCC(=O)O.
What is the InChIKey of 5-oxoundecanoic acid?
The InChIKey is LXPXOCHGDNNXCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O3/c1-2-3-4-5-7-10(12)8-6-9-11(13)14/h2-9H2,1H3,(H,13,14).
What are the key properties of 5-oxoundecanoic acid?
5-oxoundecanoic acid has a molecular weight of 200.28 g/mol, XLogP of 2.78, 9 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-oxoundecanoic acid is sourced from PubChem (CID 4667416), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).