C15H20Cl2N2O2 — CID 46677677
N-[1-(2,4-dichlorophenyl)ethyl]-2-(2-methylmorpholin-4-yl)acetamide (PubChem CID 46677677) has the molecular formula C15H20Cl2N2O2 and a molecular weight of 331.24 g/mol. Its IUPAC name is N-[1-(2,4-dichlorophenyl)ethyl]-2-(2-methylmorpholin-4-yl)acetamide.
| Compound Name | N-[1-(2,4-dichlorophenyl)ethyl]-2-(2-methylmorpholin-4-yl)acetamide |
|---|---|
| PubChem CID | 46677677 |
| Molecular Formula | C15H20Cl2N2O2 |
| Molecular Weight | 331.24 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | N-[1-(2,4-dichlorophenyl)ethyl]-2-(2-methylmorpholin-4-yl)acetamide |
| SMILES | CC1CN(CC(=O)NC(C)c2ccc(Cl)cc2Cl)CCO1 |
| InChI | InChI=1S/C15H20Cl2N2O2/c1-10-8-19(5-6-21-10)9-15(20)18-11(2)13-4-3-12(16)7-14(13)17/h3-4,7,10-11H,5-6,8-9H2,1-2H3,(H,18,20) |
| InChIKey | UJEYZWNNGGRFNI-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.24 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |