C20H23F3N2O7 — CID 46681369
4-O-[2-(5-methoxycarbonyl-2-methylanilino)-2-oxoethyl] 1-O-(2,2,2-trifluoroethyl) piperidine-1,4-dicarboxylate (PubChem CID 46681369) has the molecular formula C20H23F3N2O7 and a molecular weight of 460.41 g/mol. Its IUPAC name is 4-O-[2-(5-methoxycarbonyl-2-methylanilino)-2-oxoethyl] 1-O-(2,2,2-trifluoroethyl) piperidine-1,4-dicarboxylate.
| Compound Name | 4-O-[2-(5-methoxycarbonyl-2-methylanilino)-2-oxoethyl] 1-O-(2,2,2-trifluoroethyl) piperidine-1,4-dicarboxylate |
|---|---|
| PubChem CID | 46681369 |
| Molecular Formula | C20H23F3N2O7 |
| Molecular Weight | 460.41 g/mol |
| Exact Mass | 460.15 |
| IUPAC Name | 4-O-[2-(5-methoxycarbonyl-2-methylanilino)-2-oxoethyl] 1-O-(2,2,2-trifluoroethyl) piperidine-1,4-dicarboxylate |
| SMILES | COC(=O)c1ccc(C)c(NC(=O)COC(=O)C2CCN(C(=O)OCC(F)(F)F)CC2)c1 |
| InChI | InChI=1S/C20H23F3N2O7/c1-12-3-4-14(17(27)30-2)9-15(12)24-16(26)10-31-18(28)13-5-7-25(8-6-13)19(29)32-11-20(21,22)23/h3-4,9,13H,5-8,10-11H2,1-2H3,(H,24,26) |
| InChIKey | XCFVRNBETHXCGE-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.41 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|