C19H27FN4O2 — CID 46681642
N-cyclopropyl-2-[4-[1-(3-fluoroanilino)-1-oxopropan-2-yl]piperazin-1-yl]propanamide (PubChem CID 46681642) has the molecular formula C19H27FN4O2 and a molecular weight of 362.45 g/mol. Its IUPAC name is N-cyclopropyl-2-[4-[1-(3-fluoroanilino)-1-oxopropan-2-yl]piperazin-1-yl]propanamide.
| Compound Name | N-cyclopropyl-2-[4-[1-(3-fluoroanilino)-1-oxopropan-2-yl]piperazin-1-yl]propanamide |
|---|---|
| PubChem CID | 46681642 |
| Molecular Formula | C19H27FN4O2 |
| Molecular Weight | 362.45 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | N-cyclopropyl-2-[4-[1-(3-fluoroanilino)-1-oxopropan-2-yl]piperazin-1-yl]propanamide |
| SMILES | CC(C(=O)Nc1cccc(F)c1)N1CCN(C(C)C(=O)NC2CC2)CC1 |
| InChI | InChI=1S/C19H27FN4O2/c1-13(18(25)21-16-6-7-16)23-8-10-24(11-9-23)14(2)19(26)22-17-5-3-4-15(20)12-17/h3-5,12-14,16H,6-11H2,1-2H3,(H,21,25)(H,22,26) |
| InChIKey | HHSYWFNMQSAQEC-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.45 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |