About 2-phenyl-N-(1,3-thiazol-2-yl)quinoline-4-carboxamide
2-phenyl-N-(1,3-thiazol-2-yl)quinoline-4-carboxamide (PubChem CID 4668300) has the molecular formula C19H13N3OS
and a molecular weight of 331.40 g/mol. Its IUPAC name is 2-phenyl-N-(1,3-thiazol-2-yl)quinoline-4-carboxamide.
Molecular Properties
| Compound Name | 2-phenyl-N-(1,3-thiazol-2-yl)quinoline-4-carboxamide |
| PubChem CID | 4668300 |
| Molecular Formula | C19H13N3OS |
| Molecular Weight | 331.40 g/mol |
| Exact Mass | 331.08 |
| IUPAC Name | 2-phenyl-N-(1,3-thiazol-2-yl)quinoline-4-carboxamide |
| SMILES | O=C(Nc1nccs1)c1cc(-c2ccccc2)nc2ccccc12 |
| InChI | InChI=1S/C19H13N3OS/c23-18(22-19-20-10-11-24-19)15-12-17(13-6-2-1-3-7-13)21-16-9-5-4-8-14(15)16/h1-12H,(H,20,22,23) |
| InChIKey | XTWZGRKXEVQUKD-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.40 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-phenyl-N-(1,3-thiazol-2-yl)quinoline-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenyl-N-(1,3-thiazol-2-yl)quinoline-4-carboxamide?
The IUPAC name of 2-phenyl-N-(1,3-thiazol-2-yl)quinoline-4-carboxamide (CID 4668300) is 2-phenyl-N-(1,3-thiazol-2-yl)quinoline-4-carboxamide.
What is the SMILES notation for 2-phenyl-N-(1,3-thiazol-2-yl)quinoline-4-carboxamide?
The canonical SMILES for 2-phenyl-N-(1,3-thiazol-2-yl)quinoline-4-carboxamide is O=C(Nc1nccs1)c1cc(-c2ccccc2)nc2ccccc12.
What is the InChIKey of 2-phenyl-N-(1,3-thiazol-2-yl)quinoline-4-carboxamide?
The InChIKey is XTWZGRKXEVQUKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H13N3OS/c23-18(22-19-20-10-11-24-19)15-12-17(13-6-2-1-3-7-13)21-16-9-5-4-8-14(15)16/h1-12H,(H,20,22,23).
What are the key properties of 2-phenyl-N-(1,3-thiazol-2-yl)quinoline-4-carboxamide?
2-phenyl-N-(1,3-thiazol-2-yl)quinoline-4-carboxamide has a molecular weight of 331.40 g/mol, XLogP of 4.61, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenyl-N-(1,3-thiazol-2-yl)quinoline-4-carboxamide is sourced from PubChem (CID 4668300), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).