C23H32N2O3 — CID 4668489
1,4-dicyclohexyl-3-(4-methoxyphenyl)piperazine-2,5-dione (PubChem CID 4668489) has the molecular formula C23H32N2O3 and a molecular weight of 384.52 g/mol. Its IUPAC name is 1,4-dicyclohexyl-3-(4-methoxyphenyl)piperazine-2,5-dione.
| Compound Name | 1,4-dicyclohexyl-3-(4-methoxyphenyl)piperazine-2,5-dione |
|---|---|
| PubChem CID | 4668489 |
| Molecular Formula | C23H32N2O3 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.24 |
| IUPAC Name | 1,4-dicyclohexyl-3-(4-methoxyphenyl)piperazine-2,5-dione |
| SMILES | COc1ccc(C2C(=O)N(C3CCCCC3)CC(=O)N2C2CCCCC2)cc1 |
| InChI | InChI=1S/C23H32N2O3/c1-28-20-14-12-17(13-15-20)22-23(27)24(18-8-4-2-5-9-18)16-21(26)25(22)19-10-6-3-7-11-19/h12-15,18-19,22H,2-11,16H2,1H3 |
| InChIKey | CFRDJOTUABLFKY-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |