About 2-(2,4-dimethoxyphenyl)-4-[[4-(trifluoromethyl)pyrimidin-2-yl]sulfanylmethyl]-1,3-thiazole
2-(2,4-dimethoxyphenyl)-4-[[4-(trifluoromethyl)pyrimidin-2-yl]sulfanylmethyl]-1,3-thiazole (PubChem CID 46686043) has the molecular formula C17H14F3N3O2S2
and a molecular weight of 413.45 g/mol. Its IUPAC name is 2-(2,4-dimethoxyphenyl)-4-[[4-(trifluoromethyl)pyrimidin-2-yl]sulfanylmethyl]-1,3-thiazole.
Molecular Properties
| Compound Name | 2-(2,4-dimethoxyphenyl)-4-[[4-(trifluoromethyl)pyrimidin-2-yl]sulfanylmethyl]-1,3-thiazole |
| PubChem CID | 46686043 |
| Molecular Formula | C17H14F3N3O2S2 |
| Molecular Weight | 413.45 g/mol |
| Exact Mass | 413.05 |
| IUPAC Name | 2-(2,4-dimethoxyphenyl)-4-[[4-(trifluoromethyl)pyrimidin-2-yl]sulfanylmethyl]-1,3-thiazole |
| SMILES | COc1ccc(-c2nc(CSc3nccc(C(F)(F)F)n3)cs2)c(OC)c1 |
| InChI | InChI=1S/C17H14F3N3O2S2/c1-24-11-3-4-12(13(7-11)25-2)15-22-10(8-26-15)9-27-16-21-6-5-14(23-16)17(18,19)20/h3-8H,9H2,1-2H3 |
| InChIKey | FLBYBILMVXPKMS-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 57.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 413.45 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-(2,4-dimethoxyphenyl)-4-[[4-(trifluoromethyl)pyrimidin-2-yl]sulfanylmethyl]-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,4-dimethoxyphenyl)-4-[[4-(trifluoromethyl)pyrimidin-2-yl]sulfanylmethyl]-1,3-thiazole?
The IUPAC name of 2-(2,4-dimethoxyphenyl)-4-[[4-(trifluoromethyl)pyrimidin-2-yl]sulfanylmethyl]-1,3-thiazole (CID 46686043) is 2-(2,4-dimethoxyphenyl)-4-[[4-(trifluoromethyl)pyrimidin-2-yl]sulfanylmethyl]-1,3-thiazole.
What is the SMILES notation for 2-(2,4-dimethoxyphenyl)-4-[[4-(trifluoromethyl)pyrimidin-2-yl]sulfanylmethyl]-1,3-thiazole?
The canonical SMILES for 2-(2,4-dimethoxyphenyl)-4-[[4-(trifluoromethyl)pyrimidin-2-yl]sulfanylmethyl]-1,3-thiazole is COc1ccc(-c2nc(CSc3nccc(C(F)(F)F)n3)cs2)c(OC)c1.
What is the InChIKey of 2-(2,4-dimethoxyphenyl)-4-[[4-(trifluoromethyl)pyrimidin-2-yl]sulfanylmethyl]-1,3-thiazole?
The InChIKey is FLBYBILMVXPKMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14F3N3O2S2/c1-24-11-3-4-12(13(7-11)25-2)15-22-10(8-26-15)9-27-16-21-6-5-14(23-16)17(18,19)20/h3-8H,9H2,1-2H3.
What are the key properties of 2-(2,4-dimethoxyphenyl)-4-[[4-(trifluoromethyl)pyrimidin-2-yl]sulfanylmethyl]-1,3-thiazole?
2-(2,4-dimethoxyphenyl)-4-[[4-(trifluoromethyl)pyrimidin-2-yl]sulfanylmethyl]-1,3-thiazole has a molecular weight of 413.45 g/mol, XLogP of 4.93, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,4-dimethoxyphenyl)-4-[[4-(trifluoromethyl)pyrimidin-2-yl]sulfanylmethyl]-1,3-thiazole is sourced from PubChem (CID 46686043), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).