C22H22F3N3O4S — CID 46687087
1-phenyl-4-[4-[3-(trifluoromethyl)phenyl]sulfonylpiperazine-1-carbonyl]pyrrolidin-2-one (PubChem CID 46687087) has the molecular formula C22H22F3N3O4S and a molecular weight of 481.50 g/mol. Its IUPAC name is 1-phenyl-4-[4-[3-(trifluoromethyl)phenyl]sulfonylpiperazine-1-carbonyl]pyrrolidin-2-one.
| Compound Name | 1-phenyl-4-[4-[3-(trifluoromethyl)phenyl]sulfonylpiperazine-1-carbonyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 46687087 |
| Molecular Formula | C22H22F3N3O4S |
| Molecular Weight | 481.50 g/mol |
| Exact Mass | 481.13 |
| IUPAC Name | 1-phenyl-4-[4-[3-(trifluoromethyl)phenyl]sulfonylpiperazine-1-carbonyl]pyrrolidin-2-one |
| SMILES | O=C(C1CC(=O)N(c2ccccc2)C1)N1CCN(S(=O)(=O)c2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C22H22F3N3O4S/c23-22(24,25)17-5-4-8-19(14-17)33(31,32)27-11-9-26(10-12-27)21(30)16-13-20(29)28(15-16)18-6-2-1-3-7-18/h1-8,14,16H,9-13,15H2 |
| InChIKey | PLYWEEYDNBJQTE-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 78.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.50 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |