C23H19N3O3 — CID 46688129
1-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)ethyl 2,2-diphenylacetate (PubChem CID 46688129) has the molecular formula C23H19N3O3 and a molecular weight of 385.42 g/mol. Its IUPAC name is 1-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)ethyl 2,2-diphenylacetate.
| Compound Name | 1-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)ethyl 2,2-diphenylacetate |
|---|---|
| PubChem CID | 46688129 |
| Molecular Formula | C23H19N3O3 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | 1-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)ethyl 2,2-diphenylacetate |
| SMILES | CC(OC(=O)C(c1ccccc1)c1ccccc1)c1nc(-c2cccnc2)no1 |
| InChI | InChI=1S/C23H19N3O3/c1-16(22-25-21(26-29-22)19-13-8-14-24-15-19)28-23(27)20(17-9-4-2-5-10-17)18-11-6-3-7-12-18/h2-16,20H,1H3 |
| InChIKey | BURXVGSTFUUOJF-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 78.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |