C25H32N4O4 — CID 46688232
ethyl 4-[2-[1-(3-benzamidophenyl)ethyl-methylamino]acetyl]piperazine-1-carboxylate (PubChem CID 46688232) has the molecular formula C25H32N4O4 and a molecular weight of 452.56 g/mol. Its IUPAC name is ethyl 4-[2-[1-(3-benzamidophenyl)ethyl-methylamino]acetyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[2-[1-(3-benzamidophenyl)ethyl-methylamino]acetyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 46688232 |
| Molecular Formula | C25H32N4O4 |
| Molecular Weight | 452.56 g/mol |
| Exact Mass | 452.24 |
| IUPAC Name | ethyl 4-[2-[1-(3-benzamidophenyl)ethyl-methylamino]acetyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(=O)CN(C)C(C)c2cccc(NC(=O)c3ccccc3)c2)CC1 |
| InChI | InChI=1S/C25H32N4O4/c1-4-33-25(32)29-15-13-28(14-16-29)23(30)18-27(3)19(2)21-11-8-12-22(17-21)26-24(31)20-9-6-5-7-10-20/h5-12,17,19H,4,13-16,18H2,1-3H3,(H,26,31) |
| InChIKey | MEEHVYBMSKIZCY-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.56 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |