C9H10N4O4 — CID 4668964
2-(2,3-dihydroxypropylamino)-5-nitropyridine-3-carbonitrile (PubChem CID 4668964) has the molecular formula C9H10N4O4 and a molecular weight of 238.20 g/mol. Its IUPAC name is 2-(2,3-dihydroxypropylamino)-5-nitropyridine-3-carbonitrile.
| Compound Name | 2-(2,3-dihydroxypropylamino)-5-nitropyridine-3-carbonitrile |
|---|---|
| PubChem CID | 4668964 |
| Molecular Formula | C9H10N4O4 |
| Molecular Weight | 238.20 g/mol |
| Exact Mass | 238.07 |
| IUPAC Name | 2-(2,3-dihydroxypropylamino)-5-nitropyridine-3-carbonitrile |
| SMILES | N#Cc1cc([N+](=O)[O-])cnc1NCC(O)CO |
| InChI | InChI=1S/C9H10N4O4/c10-2-6-1-7(13(16)17)3-11-9(6)12-4-8(15)5-14/h1,3,8,14-15H,4-5H2,(H,11,12) |
| InChIKey | BGKVIAKFOYSKOZ-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 132.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.20 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|