C26H25ClN4O3 — CID 46690243
N-[5-chloro-2-(4-ethoxyphenoxy)phenyl]-1-(5-cyano-2-pyridinyl)piperidine-4-carboxamide (PubChem CID 46690243) has the molecular formula C26H25ClN4O3 and a molecular weight of 476.96 g/mol. Its IUPAC name is N-[5-chloro-2-(4-ethoxyphenoxy)phenyl]-1-(5-cyano-2-pyridinyl)piperidine-4-carboxamide.
| Compound Name | N-[5-chloro-2-(4-ethoxyphenoxy)phenyl]-1-(5-cyano-2-pyridinyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 46690243 |
| Molecular Formula | C26H25ClN4O3 |
| Molecular Weight | 476.96 g/mol |
| Exact Mass | 476.16 |
| IUPAC Name | N-[5-chloro-2-(4-ethoxyphenoxy)phenyl]-1-(5-cyano-2-pyridinyl)piperidine-4-carboxamide |
| SMILES | CCOc1ccc(Oc2ccc(Cl)cc2NC(=O)C2CCN(c3ccc(C#N)cn3)CC2)cc1 |
| InChI | InChI=1S/C26H25ClN4O3/c1-2-33-21-5-7-22(8-6-21)34-24-9-4-20(27)15-23(24)30-26(32)19-11-13-31(14-12-19)25-10-3-18(16-28)17-29-25/h3-10,15,17,19H,2,11-14H2,1H3,(H,30,32) |
| InChIKey | CLQCBTOIMNCQES-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 87.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.96 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |