C22H21N5O3 — CID 46690725
1-(5-cyano-2-pyridinyl)-N'-(3-methyl-1-benzofuran-2-carbonyl)piperidine-4-carbohydrazide (PubChem CID 46690725) has the molecular formula C22H21N5O3 and a molecular weight of 403.44 g/mol. Its IUPAC name is 1-(5-cyano-2-pyridinyl)-N'-(3-methyl-1-benzofuran-2-carbonyl)piperidine-4-carbohydrazide.
| Compound Name | 1-(5-cyano-2-pyridinyl)-N'-(3-methyl-1-benzofuran-2-carbonyl)piperidine-4-carbohydrazide |
|---|---|
| PubChem CID | 46690725 |
| Molecular Formula | C22H21N5O3 |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | 1-(5-cyano-2-pyridinyl)-N'-(3-methyl-1-benzofuran-2-carbonyl)piperidine-4-carbohydrazide |
| SMILES | Cc1c(C(=O)NNC(=O)C2CCN(c3ccc(C#N)cn3)CC2)oc2ccccc12 |
| InChI | InChI=1S/C22H21N5O3/c1-14-17-4-2-3-5-18(17)30-20(14)22(29)26-25-21(28)16-8-10-27(11-9-16)19-7-6-15(12-23)13-24-19/h2-7,13,16H,8-11H2,1H3,(H,25,28)(H,26,29) |
| InChIKey | BHDOWHZYFRRXOZ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 111.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|