C15H13N3 — CID 4669245
1,4-diphenylpyrazol-5-amine (PubChem CID 4669245) has the molecular formula C15H13N3 and a molecular weight of 235.29 g/mol. Its IUPAC name is 1,4-diphenylpyrazol-5-amine.
| Compound Name | 1,4-diphenylpyrazol-5-amine |
|---|---|
| PubChem CID | 4669245 |
| Molecular Formula | C15H13N3 |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.11 |
| IUPAC Name | 1,4-diphenylpyrazol-5-amine |
| SMILES | Nc1c(-c2ccccc2)cnn1-c1ccccc1 |
| InChI | InChI=1S/C15H13N3/c16-15-14(12-7-3-1-4-8-12)11-17-18(15)13-9-5-2-6-10-13/h1-11H,16H2 |
| InChIKey | OGWIUGFQFNQLNI-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |