C24H23ClN4O2 — CID 46692727
(E)-N-[3-chloro-4-(2-oxopyrrolidin-1-yl)phenyl]-3-(3,5-dimethyl-1-phenylpyrazol-4-yl)prop-2-enamide (PubChem CID 46692727) has the molecular formula C24H23ClN4O2 and a molecular weight of 434.93 g/mol. Its IUPAC name is (E)-N-[3-chloro-4-(2-oxopyrrolidin-1-yl)phenyl]-3-(3,5-dimethyl-1-phenylpyrazol-4-yl)prop-2-enamide.
| Compound Name | (E)-N-[3-chloro-4-(2-oxopyrrolidin-1-yl)phenyl]-3-(3,5-dimethyl-1-phenylpyrazol-4-yl)prop-2-enamide |
|---|---|
| PubChem CID | 46692727 |
| Molecular Formula | C24H23ClN4O2 |
| Molecular Weight | 434.93 g/mol |
| Exact Mass | 434.15 |
| IUPAC Name | (E)-N-[3-chloro-4-(2-oxopyrrolidin-1-yl)phenyl]-3-(3,5-dimethyl-1-phenylpyrazol-4-yl)prop-2-enamide |
| SMILES | Cc1nn(-c2ccccc2)c(C)c1/C=C/C(=O)Nc1ccc(N2CCCC2=O)c(Cl)c1 |
| InChI | InChI=1S/C24H23ClN4O2/c1-16-20(17(2)29(27-16)19-7-4-3-5-8-19)11-13-23(30)26-18-10-12-22(21(25)15-18)28-14-6-9-24(28)31/h3-5,7-8,10-13,15H,6,9,14H2,1-2H3,(H,26,30)/b13-11+ |
| InChIKey | MICISUDBFWZJHV-ACCUITESSA-N |
| XLogP | 4.92 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.93 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|