C27H25ClN4O4 — CID 4669332
1-[3-(1,3-benzodioxol-5-yl)-2-(4-chlorophenyl)-4-(4-morpholin-4-ylphenyl)-3H-1,2,4-triazol-5-yl]ethanone (PubChem CID 4669332) has the molecular formula C27H25ClN4O4 and a molecular weight of 504.97 g/mol. Its IUPAC name is 1-[3-(1,3-benzodioxol-5-yl)-2-(4-chlorophenyl)-4-(4-morpholin-4-ylphenyl)-3H-1,2,4-triazol-5-yl]ethanone.
| Compound Name | 1-[3-(1,3-benzodioxol-5-yl)-2-(4-chlorophenyl)-4-(4-morpholin-4-ylphenyl)-3H-1,2,4-triazol-5-yl]ethanone |
|---|---|
| PubChem CID | 4669332 |
| Molecular Formula | C27H25ClN4O4 |
| Molecular Weight | 504.97 g/mol |
| Exact Mass | 504.16 |
| IUPAC Name | 1-[3-(1,3-benzodioxol-5-yl)-2-(4-chlorophenyl)-4-(4-morpholin-4-ylphenyl)-3H-1,2,4-triazol-5-yl]ethanone |
| SMILES | CC(=O)C1=NN(c2ccc(Cl)cc2)C(c2ccc3c(c2)OCO3)N1c1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C27H25ClN4O4/c1-18(33)26-29-32(23-5-3-20(28)4-6-23)27(19-2-11-24-25(16-19)36-17-35-24)31(26)22-9-7-21(8-10-22)30-12-14-34-15-13-30/h2-11,16,27H,12-15,17H2,1H3 |
| InChIKey | ZHGBQVGROHFQAL-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 66.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.97 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|