C21H20N4O3S4 — CID 4669600
N-[5-[4,5-dimethyl-3-(1,3-thiazol-2-yl)-1,3-thiazol-2-ylidene]-4-oxo-3-prop-2-enyl-1,3-thiazolidin-2-ylidene]-4-methylbenzenesulfonamide (PubChem CID 4669600) has the molecular formula C21H20N4O3S4 and a molecular weight of 504.68 g/mol. Its IUPAC name is N-[5-[4,5-dimethyl-3-(1,3-thiazol-2-yl)-1,3-thiazol-2-ylidene]-4-oxo-3-prop-2-enyl-1,3-thiazolidin-2-ylidene]-4-methylbenzenesulfonamide.
| Compound Name | N-[5-[4,5-dimethyl-3-(1,3-thiazol-2-yl)-1,3-thiazol-2-ylidene]-4-oxo-3-prop-2-enyl-1,3-thiazolidin-2-ylidene]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 4669600 |
| Molecular Formula | C21H20N4O3S4 |
| Molecular Weight | 504.68 g/mol |
| Exact Mass | 504.04 |
| IUPAC Name | N-[5-[4,5-dimethyl-3-(1,3-thiazol-2-yl)-1,3-thiazol-2-ylidene]-4-oxo-3-prop-2-enyl-1,3-thiazolidin-2-ylidene]-4-methylbenzenesulfonamide |
| SMILES | C=CCN1C(=O)C(=C2SC(C)=C(C)N2c2nccs2)SC1=NS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C21H20N4O3S4/c1-5-11-24-18(26)17(19-25(14(3)15(4)30-19)20-22-10-12-29-20)31-21(24)23-32(27,28)16-8-6-13(2)7-9-16/h5-10,12H,1,11H2,2-4H3 |
| InChIKey | RRCJAGGPAQKPCA-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 82.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.68 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|