About [4-(trifluoromethyl)phenyl]methyl 7-fluoro-2-oxo-3,4-dihydro-1H-quinoline-4-carboxylate
[4-(trifluoromethyl)phenyl]methyl 7-fluoro-2-oxo-3,4-dihydro-1H-quinoline-4-carboxylate (PubChem CID 46696034) has the molecular formula C18H13F4NO3
and a molecular weight of 367.30 g/mol. Its IUPAC name is [4-(trifluoromethyl)phenyl]methyl 7-fluoro-2-oxo-3,4-dihydro-1H-quinoline-4-carboxylate.
Molecular Properties
| Compound Name | [4-(trifluoromethyl)phenyl]methyl 7-fluoro-2-oxo-3,4-dihydro-1H-quinoline-4-carboxylate |
| PubChem CID | 46696034 |
| Molecular Formula | C18H13F4NO3 |
| Molecular Weight | 367.30 g/mol |
| Exact Mass | 367.08 |
| IUPAC Name | [4-(trifluoromethyl)phenyl]methyl 7-fluoro-2-oxo-3,4-dihydro-1H-quinoline-4-carboxylate |
| SMILES | O=C1CC(C(=O)OCc2ccc(C(F)(F)F)cc2)c2ccc(F)cc2N1 |
| InChI | InChI=1S/C18H13F4NO3/c19-12-5-6-13-14(8-16(24)23-15(13)7-12)17(25)26-9-10-1-3-11(4-2-10)18(20,21)22/h1-7,14H,8-9H2,(H,23,24) |
| InChIKey | MSJSKKIDRKOSKD-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.30 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [4-(trifluoromethyl)phenyl]methyl 7-fluoro-2-oxo-3,4-dihydro-1H-quinoline-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(trifluoromethyl)phenyl]methyl 7-fluoro-2-oxo-3,4-dihydro-1H-quinoline-4-carboxylate?
The IUPAC name of [4-(trifluoromethyl)phenyl]methyl 7-fluoro-2-oxo-3,4-dihydro-1H-quinoline-4-carboxylate (CID 46696034) is [4-(trifluoromethyl)phenyl]methyl 7-fluoro-2-oxo-3,4-dihydro-1H-quinoline-4-carboxylate.
What is the SMILES notation for [4-(trifluoromethyl)phenyl]methyl 7-fluoro-2-oxo-3,4-dihydro-1H-quinoline-4-carboxylate?
The canonical SMILES for [4-(trifluoromethyl)phenyl]methyl 7-fluoro-2-oxo-3,4-dihydro-1H-quinoline-4-carboxylate is O=C1CC(C(=O)OCc2ccc(C(F)(F)F)cc2)c2ccc(F)cc2N1.
What is the InChIKey of [4-(trifluoromethyl)phenyl]methyl 7-fluoro-2-oxo-3,4-dihydro-1H-quinoline-4-carboxylate?
The InChIKey is MSJSKKIDRKOSKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13F4NO3/c19-12-5-6-13-14(8-16(24)23-15(13)7-12)17(25)26-9-10-1-3-11(4-2-10)18(20,21)22/h1-7,14H,8-9H2,(H,23,24).
What are the key properties of [4-(trifluoromethyl)phenyl]methyl 7-fluoro-2-oxo-3,4-dihydro-1H-quinoline-4-carboxylate?
[4-(trifluoromethyl)phenyl]methyl 7-fluoro-2-oxo-3,4-dihydro-1H-quinoline-4-carboxylate has a molecular weight of 367.30 g/mol, XLogP of 4.01, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(trifluoromethyl)phenyl]methyl 7-fluoro-2-oxo-3,4-dihydro-1H-quinoline-4-carboxylate is sourced from PubChem (CID 46696034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).