C18H14Cl2FNO4 — CID 46696152
2-(2,6-dichlorophenoxy)ethyl 7-fluoro-2-oxo-3,4-dihydro-1H-quinoline-4-carboxylate (PubChem CID 46696152) has the molecular formula C18H14Cl2FNO4 and a molecular weight of 398.22 g/mol. Its IUPAC name is 2-(2,6-dichlorophenoxy)ethyl 7-fluoro-2-oxo-3,4-dihydro-1H-quinoline-4-carboxylate.
| Compound Name | 2-(2,6-dichlorophenoxy)ethyl 7-fluoro-2-oxo-3,4-dihydro-1H-quinoline-4-carboxylate |
|---|---|
| PubChem CID | 46696152 |
| Molecular Formula | C18H14Cl2FNO4 |
| Molecular Weight | 398.22 g/mol |
| Exact Mass | 397.03 |
| IUPAC Name | 2-(2,6-dichlorophenoxy)ethyl 7-fluoro-2-oxo-3,4-dihydro-1H-quinoline-4-carboxylate |
| SMILES | O=C1CC(C(=O)OCCOc2c(Cl)cccc2Cl)c2ccc(F)cc2N1 |
| InChI | InChI=1S/C18H14Cl2FNO4/c19-13-2-1-3-14(20)17(13)25-6-7-26-18(24)12-9-16(23)22-15-8-10(21)4-5-11(12)15/h1-5,8,12H,6-7,9H2,(H,22,23) |
| InChIKey | ORNPUIBLXTXRHH-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.22 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|