C22H20N2O3 — CID 46696700
[2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl] 2-quinolin-8-ylacetate (PubChem CID 46696700) has the molecular formula C22H20N2O3 and a molecular weight of 360.41 g/mol. Its IUPAC name is [2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl] 2-quinolin-8-ylacetate.
| Compound Name | [2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl] 2-quinolin-8-ylacetate |
|---|---|
| PubChem CID | 46696700 |
| Molecular Formula | C22H20N2O3 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | [2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl] 2-quinolin-8-ylacetate |
| SMILES | O=C(Cc1cccc2cccnc12)OCC(=O)N1CCCc2ccccc21 |
| InChI | InChI=1S/C22H20N2O3/c25-20(24-13-5-10-16-6-1-2-11-19(16)24)15-27-21(26)14-18-8-3-7-17-9-4-12-23-22(17)18/h1-4,6-9,11-12H,5,10,13-15H2 |
| InChIKey | NYUOUKVOZUDWOY-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |