C20H15Cl2FN2O — CID 46699903
(2,4-dichloro-5-fluorophenyl)-[4-(1H-indol-3-yl)-3,6-dihydro-2H-pyridin-1-yl]methanone (PubChem CID 46699903) has the molecular formula C20H15Cl2FN2O and a molecular weight of 389.26 g/mol. Its IUPAC name is (2,4-dichloro-5-fluorophenyl)-[4-(1H-indol-3-yl)-3,6-dihydro-2H-pyridin-1-yl]methanone.
| Compound Name | (2,4-dichloro-5-fluorophenyl)-[4-(1H-indol-3-yl)-3,6-dihydro-2H-pyridin-1-yl]methanone |
|---|---|
| PubChem CID | 46699903 |
| Molecular Formula | C20H15Cl2FN2O |
| Molecular Weight | 389.26 g/mol |
| Exact Mass | 388.05 |
| IUPAC Name | (2,4-dichloro-5-fluorophenyl)-[4-(1H-indol-3-yl)-3,6-dihydro-2H-pyridin-1-yl]methanone |
| SMILES | O=C(c1cc(F)c(Cl)cc1Cl)N1CC=C(c2c[nH]c3ccccc23)CC1 |
| InChI | InChI=1S/C20H15Cl2FN2O/c21-16-10-17(22)18(23)9-14(16)20(26)25-7-5-12(6-8-25)15-11-24-19-4-2-1-3-13(15)19/h1-5,9-11,24H,6-8H2 |
| InChIKey | LVTNYMJXOVVUCT-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.26 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|