C14H17Cl2N — CID 46701087
(3aS,7aR)-7a-(3,4-dichlorophenyl)-1,2,3,3a,4,5,6,7-octahydroisoindole (PubChem CID 46701087) has the molecular formula C14H17Cl2N and a molecular weight of 270.20 g/mol. Its IUPAC name is (3aS,7aR)-7a-(3,4-dichlorophenyl)-1,2,3,3a,4,5,6,7-octahydroisoindole.
| Compound Name | (3aS,7aR)-7a-(3,4-dichlorophenyl)-1,2,3,3a,4,5,6,7-octahydroisoindole |
|---|---|
| PubChem CID | 46701087 |
| Molecular Formula | C14H17Cl2N |
| Molecular Weight | 270.20 g/mol |
| Exact Mass | 269.07 |
| IUPAC Name | (3aS,7aR)-7a-(3,4-dichlorophenyl)-1,2,3,3a,4,5,6,7-octahydroisoindole |
| SMILES | Clc1ccc([C@@]23CCCC[C@@H]2CNC3)cc1Cl |
| InChI | InChI=1S/C14H17Cl2N/c15-12-5-4-10(7-13(12)16)14-6-2-1-3-11(14)8-17-9-14/h4-5,7,11,17H,1-3,6,8-9H2/t11-,14+/m1/s1 |
| InChIKey | UIBIRCANCAKLIN-RISCZKNCSA-N |
| XLogP | 4.02 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.20 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |