C14H20Cl2O4 — CID 46702146
[(1S,4Z,8R)-8-(2,2-dichloroacetyl)oxycyclooct-4-en-1-yl] 2-methylpropanoate (PubChem CID 46702146) has the molecular formula C14H20Cl2O4 and a molecular weight of 323.22 g/mol. Its IUPAC name is [(1S,4Z,8R)-8-(2,2-dichloroacetyl)oxycyclooct-4-en-1-yl] 2-methylpropanoate.
| Compound Name | [(1S,4Z,8R)-8-(2,2-dichloroacetyl)oxycyclooct-4-en-1-yl] 2-methylpropanoate |
|---|---|
| PubChem CID | 46702146 |
| Molecular Formula | C14H20Cl2O4 |
| Molecular Weight | 323.22 g/mol |
| Exact Mass | 322.07 |
| IUPAC Name | [(1S,4Z,8R)-8-(2,2-dichloroacetyl)oxycyclooct-4-en-1-yl] 2-methylpropanoate |
| SMILES | CC(C)C(=O)O[C@H]1CC/C=C\CC[C@H]1OC(=O)C(Cl)Cl |
| InChI | InChI=1S/C14H20Cl2O4/c1-9(2)13(17)19-10-7-5-3-4-6-8-11(10)20-14(18)12(15)16/h3-4,9-12H,5-8H2,1-2H3/b4-3-/t10-,11+/m0/s1 |
| InChIKey | LROFZVYJFFRZHV-CBZSPVTBSA-N |
| XLogP | 3.40 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.22 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|