C42H42N4O2 — CID 46702397
3-[[[4-hydroxy-9-(3-methylbut-2-enyl)carbazol-3-yl]methyl-(pyridin-2-ylmethyl)amino]methyl]-9-(3-methylbut-2-enyl)carbazol-4-ol (PubChem CID 46702397) has the molecular formula C42H42N4O2 and a molecular weight of 634.82 g/mol. Its IUPAC name is 3-[[[4-hydroxy-9-(3-methylbut-2-enyl)carbazol-3-yl]methyl-(pyridin-2-ylmethyl)amino]methyl]-9-(3-methylbut-2-enyl)carbazol-4-ol.
| Compound Name | 3-[[[4-hydroxy-9-(3-methylbut-2-enyl)carbazol-3-yl]methyl-(pyridin-2-ylmethyl)amino]methyl]-9-(3-methylbut-2-enyl)carbazol-4-ol |
|---|---|
| PubChem CID | 46702397 |
| Molecular Formula | C42H42N4O2 |
| Molecular Weight | 634.82 g/mol |
| Exact Mass | 634.33 |
| IUPAC Name | 3-[[[4-hydroxy-9-(3-methylbut-2-enyl)carbazol-3-yl]methyl-(pyridin-2-ylmethyl)amino]methyl]-9-(3-methylbut-2-enyl)carbazol-4-ol |
| SMILES | CC(C)=CCn1c2ccccc2c2c(O)c(CN(Cc3ccccn3)Cc3ccc4c(c3O)c3ccccc3n4CC=C(C)C)ccc21 |
| InChI | InChI=1S/C42H42N4O2/c1-28(2)20-23-45-35-14-7-5-12-33(35)39-37(45)18-16-30(41(39)47)25-44(27-32-11-9-10-22-43-32)26-31-17-19-38-40(42(31)48)34-13-6-8-15-36(34)46(38)24-21-29(3)4/h5-22,47-48H,23-27H2,1-4H3 |
| InChIKey | OLLKICISKJZNHT-UHFFFAOYSA-N |
| XLogP | 9.84 |
| TPSA | 66.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.82 |
| LogP ≤ 5 | 9.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|