C22H22ClNO4S — CID 46702770
methyl (3S,3aR,7aS)-2-(benzenesulfonyl)-3-(4-chlorophenyl)-3,4,5,7a-tetrahydro-1H-isoindole-3a-carboxylate (PubChem CID 46702770) has the molecular formula C22H22ClNO4S and a molecular weight of 431.94 g/mol. Its IUPAC name is methyl (3S,3aR,7aS)-2-(benzenesulfonyl)-3-(4-chlorophenyl)-3,4,5,7a-tetrahydro-1H-isoindole-3a-carboxylate.
| Compound Name | methyl (3S,3aR,7aS)-2-(benzenesulfonyl)-3-(4-chlorophenyl)-3,4,5,7a-tetrahydro-1H-isoindole-3a-carboxylate |
|---|---|
| PubChem CID | 46702770 |
| Molecular Formula | C22H22ClNO4S |
| Molecular Weight | 431.94 g/mol |
| Exact Mass | 431.10 |
| IUPAC Name | methyl (3S,3aR,7aS)-2-(benzenesulfonyl)-3-(4-chlorophenyl)-3,4,5,7a-tetrahydro-1H-isoindole-3a-carboxylate |
| SMILES | COC(=O)[C@]12CCC=C[C@@H]1CN(S(=O)(=O)c1ccccc1)[C@H]2c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H22ClNO4S/c1-28-21(25)22-14-6-5-7-17(22)15-24(20(22)16-10-12-18(23)13-11-16)29(26,27)19-8-3-2-4-9-19/h2-5,7-13,17,20H,6,14-15H2,1H3/t17-,20+,22-/m1/s1 |
| InChIKey | FSBBZKKLPHQPLD-PIPMEXSNSA-N |
| XLogP | 4.21 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.94 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|