C18H20O2 — CID 46703005
2,5-di(cyclohex-2-en-1-yl)cyclohexa-2,5-diene-1,4-dione (PubChem CID 46703005) has the molecular formula C18H20O2 and a molecular weight of 268.36 g/mol. Its IUPAC name is 2,5-di(cyclohex-2-en-1-yl)cyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2,5-di(cyclohex-2-en-1-yl)cyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 46703005 |
| Molecular Formula | C18H20O2 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | 2,5-di(cyclohex-2-en-1-yl)cyclohexa-2,5-diene-1,4-dione |
| SMILES | O=C1C=C(C2C=CCCC2)C(=O)C=C1C1C=CCCC1 |
| InChI | InChI=1S/C18H20O2/c19-17-12-16(14-9-5-2-6-10-14)18(20)11-15(17)13-7-3-1-4-8-13/h3,5,7,9,11-14H,1-2,4,6,8,10H2 |
| InChIKey | KQBSQLOEOXBTKV-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|