C19H32O6 — CID 46703151
[(6R,9R,10S)-6,10-dimethyl-9-[(2S)-3-oxopentan-2-yl]-1,4,8-trioxaspiro[4.5]decan-7-yl] 2,2-dimethylpropanoate (PubChem CID 46703151) has the molecular formula C19H32O6 and a molecular weight of 356.46 g/mol. Its IUPAC name is [(6R,9R,10S)-6,10-dimethyl-9-[(2S)-3-oxopentan-2-yl]-1,4,8-trioxaspiro[4.5]decan-7-yl] 2,2-dimethylpropanoate.
| Compound Name | [(6R,9R,10S)-6,10-dimethyl-9-[(2S)-3-oxopentan-2-yl]-1,4,8-trioxaspiro[4.5]decan-7-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 46703151 |
| Molecular Formula | C19H32O6 |
| Molecular Weight | 356.46 g/mol |
| Exact Mass | 356.22 |
| IUPAC Name | [(6R,9R,10S)-6,10-dimethyl-9-[(2S)-3-oxopentan-2-yl]-1,4,8-trioxaspiro[4.5]decan-7-yl] 2,2-dimethylpropanoate |
| SMILES | CCC(=O)[C@@H](C)[C@H]1OC(OC(=O)C(C)(C)C)[C@@H](C)C2(OCCO2)[C@H]1C |
| InChI | InChI=1S/C19H32O6/c1-8-14(20)11(2)15-12(3)19(22-9-10-23-19)13(4)16(24-15)25-17(21)18(5,6)7/h11-13,15-16H,8-10H2,1-7H3/t11-,12+,13-,15-,16?/m1/s1 |
| InChIKey | OWRRCHUCBZZVAU-FETWPZQLSA-N |
| XLogP | 2.93 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.46 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |