C26H30O6 — CID 46703209
5-(cyclohexylmethoxy)-3-[(3,4,5-trimethoxyphenyl)methyl]chromen-4-one (PubChem CID 46703209) has the molecular formula C26H30O6 and a molecular weight of 438.52 g/mol. Its IUPAC name is 5-(cyclohexylmethoxy)-3-[(3,4,5-trimethoxyphenyl)methyl]chromen-4-one.
| Compound Name | 5-(cyclohexylmethoxy)-3-[(3,4,5-trimethoxyphenyl)methyl]chromen-4-one |
|---|---|
| PubChem CID | 46703209 |
| Molecular Formula | C26H30O6 |
| Molecular Weight | 438.52 g/mol |
| Exact Mass | 438.20 |
| IUPAC Name | 5-(cyclohexylmethoxy)-3-[(3,4,5-trimethoxyphenyl)methyl]chromen-4-one |
| SMILES | COc1cc(Cc2coc3cccc(OCC4CCCCC4)c3c2=O)cc(OC)c1OC |
| InChI | InChI=1S/C26H30O6/c1-28-22-13-18(14-23(29-2)26(22)30-3)12-19-16-32-21-11-7-10-20(24(21)25(19)27)31-15-17-8-5-4-6-9-17/h7,10-11,13-14,16-17H,4-6,8-9,12,15H2,1-3H3 |
| InChIKey | ZYQQFTUVZFRNSG-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 67.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.52 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |