C18H21NO7 — CID 46703274
methyl (3aR,6R,6aS)-6-(hydroxymethyl)-5-[(4-methoxyphenyl)methyl]-6a-methyl-2,4-dioxo-3,3a-dihydrofuro[2,3-c]pyrrole-6-carboxylate (PubChem CID 46703274) has the molecular formula C18H21NO7 and a molecular weight of 363.37 g/mol. Its IUPAC name is methyl (3aR,6R,6aS)-6-(hydroxymethyl)-5-[(4-methoxyphenyl)methyl]-6a-methyl-2,4-dioxo-3,3a-dihydrofuro[2,3-c]pyrrole-6-carboxylate.
| Compound Name | methyl (3aR,6R,6aS)-6-(hydroxymethyl)-5-[(4-methoxyphenyl)methyl]-6a-methyl-2,4-dioxo-3,3a-dihydrofuro[2,3-c]pyrrole-6-carboxylate |
|---|---|
| PubChem CID | 46703274 |
| Molecular Formula | C18H21NO7 |
| Molecular Weight | 363.37 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | methyl (3aR,6R,6aS)-6-(hydroxymethyl)-5-[(4-methoxyphenyl)methyl]-6a-methyl-2,4-dioxo-3,3a-dihydrofuro[2,3-c]pyrrole-6-carboxylate |
| SMILES | COC(=O)[C@]1(CO)N(Cc2ccc(OC)cc2)C(=O)[C@@H]2CC(=O)O[C@@]21C |
| InChI | InChI=1S/C18H21NO7/c1-17-13(8-14(21)26-17)15(22)19(18(17,10-20)16(23)25-3)9-11-4-6-12(24-2)7-5-11/h4-7,13,20H,8-10H2,1-3H3/t13-,17-,18-/m0/s1 |
| InChIKey | GBFACDPRDINTAE-KKXDTOCCSA-N |
| XLogP | 0.26 |
| TPSA | 102.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.37 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |