About (3S)-3-[(R)-[(6S)-1,4-dioxa-8-thiaspiro[4.5]decan-6-yl]-(methoxymethoxy)methyl]thian-4-one
(3S)-3-[(R)-[(6S)-1,4-dioxa-8-thiaspiro[4.5]decan-6-yl]-(methoxymethoxy)methyl]thian-4-one (PubChem CID 46703292) has the molecular formula C15H24O5S2
and a molecular weight of 348.49 g/mol. Its IUPAC name is (3S)-3-[(R)-[(6S)-1,4-dioxa-8-thiaspiro[4.5]decan-6-yl]-(methoxymethoxy)methyl]thian-4-one.
Molecular Properties
| Compound Name | (3S)-3-[(R)-[(6S)-1,4-dioxa-8-thiaspiro[4.5]decan-6-yl]-(methoxymethoxy)methyl]thian-4-one |
| PubChem CID | 46703292 |
| Molecular Formula | C15H24O5S2 |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | (3S)-3-[(R)-[(6S)-1,4-dioxa-8-thiaspiro[4.5]decan-6-yl]-(methoxymethoxy)methyl]thian-4-one |
| SMILES | COCO[C@H]([C@@H]1CSCCC1=O)[C@@H]1CSCCC12OCCO2 |
| InChI | InChI=1S/C15H24O5S2/c1-17-10-18-14(11-8-21-6-2-13(11)16)12-9-22-7-3-15(12)19-4-5-20-15/h11-12,14H,2-10H2,1H3/t11-,12+,14-/m1/s1 |
| InChIKey | VAUFIOWDVWNSQH-MBNYWOFBSA-N |
| XLogP | 1.79 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze (3S)-3-[(R)-[(6S)-1,4-dioxa-8-thiaspiro[4.5]decan-6-yl]-(methoxymethoxy)methyl]thian-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-[(R)-[(6S)-1,4-dioxa-8-thiaspiro[4.5]decan-6-yl]-(methoxymethoxy)methyl]thian-4-one?
The IUPAC name of (3S)-3-[(R)-[(6S)-1,4-dioxa-8-thiaspiro[4.5]decan-6-yl]-(methoxymethoxy)methyl]thian-4-one (CID 46703292) is (3S)-3-[(R)-[(6S)-1,4-dioxa-8-thiaspiro[4.5]decan-6-yl]-(methoxymethoxy)methyl]thian-4-one.
What is the SMILES notation for (3S)-3-[(R)-[(6S)-1,4-dioxa-8-thiaspiro[4.5]decan-6-yl]-(methoxymethoxy)methyl]thian-4-one?
The canonical SMILES for (3S)-3-[(R)-[(6S)-1,4-dioxa-8-thiaspiro[4.5]decan-6-yl]-(methoxymethoxy)methyl]thian-4-one is COCO[C@H]([C@@H]1CSCCC1=O)[C@@H]1CSCCC12OCCO2.
What is the InChIKey of (3S)-3-[(R)-[(6S)-1,4-dioxa-8-thiaspiro[4.5]decan-6-yl]-(methoxymethoxy)methyl]thian-4-one?
The InChIKey is VAUFIOWDVWNSQH-MBNYWOFBSA-N. The full InChI is InChI=1S/C15H24O5S2/c1-17-10-18-14(11-8-21-6-2-13(11)16)12-9-22-7-3-15(12)19-4-5-20-15/h11-12,14H,2-10H2,1H3/t11-,12+,14-/m1/s1.
What are the key properties of (3S)-3-[(R)-[(6S)-1,4-dioxa-8-thiaspiro[4.5]decan-6-yl]-(methoxymethoxy)methyl]thian-4-one?
(3S)-3-[(R)-[(6S)-1,4-dioxa-8-thiaspiro[4.5]decan-6-yl]-(methoxymethoxy)methyl]thian-4-one has a molecular weight of 348.49 g/mol, XLogP of 1.79, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-[(R)-[(6S)-1,4-dioxa-8-thiaspiro[4.5]decan-6-yl]-(methoxymethoxy)methyl]thian-4-one is sourced from PubChem (CID 46703292), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).