About 3-oxido-5-[[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]methyl]-2,1,3-benzoxadiazol-3-ium
3-oxido-5-[[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]methyl]-2,1,3-benzoxadiazol-3-ium (PubChem CID 46703299) has the molecular formula C20H22N4O2
and a molecular weight of 350.42 g/mol. Its IUPAC name is 3-oxido-5-[[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]methyl]-2,1,3-benzoxadiazol-3-ium.
Molecular Properties
| Compound Name | 3-oxido-5-[[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]methyl]-2,1,3-benzoxadiazol-3-ium |
| PubChem CID | 46703299 |
| Molecular Formula | C20H22N4O2 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | 3-oxido-5-[[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]methyl]-2,1,3-benzoxadiazol-3-ium |
| SMILES | [O-][n+]1onc2ccc(CN3CCN(C/C=C/c4ccccc4)CC3)cc21 |
| InChI | InChI=1S/C20H22N4O2/c25-24-20-15-18(8-9-19(20)21-26-24)16-23-13-11-22(12-14-23)10-4-7-17-5-2-1-3-6-17/h1-9,15H,10-14,16H2/b7-4+ |
| InChIKey | HBKQCXKXFPSIPH-QPJJXVBHSA-N |
| XLogP | 2.29 |
| TPSA | 59.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'} |
|---|
Analyze 3-oxido-5-[[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]methyl]-2,1,3-benzoxadiazol-3-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-oxido-5-[[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]methyl]-2,1,3-benzoxadiazol-3-ium?
The IUPAC name of 3-oxido-5-[[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]methyl]-2,1,3-benzoxadiazol-3-ium (CID 46703299) is 3-oxido-5-[[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]methyl]-2,1,3-benzoxadiazol-3-ium.
What is the SMILES notation for 3-oxido-5-[[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]methyl]-2,1,3-benzoxadiazol-3-ium?
The canonical SMILES for 3-oxido-5-[[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]methyl]-2,1,3-benzoxadiazol-3-ium is [O-][n+]1onc2ccc(CN3CCN(C/C=C/c4ccccc4)CC3)cc21.
What is the InChIKey of 3-oxido-5-[[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]methyl]-2,1,3-benzoxadiazol-3-ium?
The InChIKey is HBKQCXKXFPSIPH-QPJJXVBHSA-N. The full InChI is InChI=1S/C20H22N4O2/c25-24-20-15-18(8-9-19(20)21-26-24)16-23-13-11-22(12-14-23)10-4-7-17-5-2-1-3-6-17/h1-9,15H,10-14,16H2/b7-4+.
What are the key properties of 3-oxido-5-[[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]methyl]-2,1,3-benzoxadiazol-3-ium?
3-oxido-5-[[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]methyl]-2,1,3-benzoxadiazol-3-ium has a molecular weight of 350.42 g/mol, XLogP of 2.29, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-oxido-5-[[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]methyl]-2,1,3-benzoxadiazol-3-ium is sourced from PubChem (CID 46703299), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).