C26H33NO5 — CID 46703396
ethyl 4-[(3R,5E,7aS,11aS)-5-(2-methoxy-2-oxoethylidene)-3-phenyl-3,6,7,7a,10,11-hexahydro-2H-[1,3]oxazolo[2,3-j]quinolin-8-yl]butanoate (PubChem CID 46703396) has the molecular formula C26H33NO5 and a molecular weight of 439.55 g/mol. Its IUPAC name is ethyl 4-[(3R,5E,7aS,11aS)-5-(2-methoxy-2-oxoethylidene)-3-phenyl-3,6,7,7a,10,11-hexahydro-2H-[1,3]oxazolo[2,3-j]quinolin-8-yl]butanoate.
| Compound Name | ethyl 4-[(3R,5E,7aS,11aS)-5-(2-methoxy-2-oxoethylidene)-3-phenyl-3,6,7,7a,10,11-hexahydro-2H-[1,3]oxazolo[2,3-j]quinolin-8-yl]butanoate |
|---|---|
| PubChem CID | 46703396 |
| Molecular Formula | C26H33NO5 |
| Molecular Weight | 439.55 g/mol |
| Exact Mass | 439.24 |
| IUPAC Name | ethyl 4-[(3R,5E,7aS,11aS)-5-(2-methoxy-2-oxoethylidene)-3-phenyl-3,6,7,7a,10,11-hexahydro-2H-[1,3]oxazolo[2,3-j]quinolin-8-yl]butanoate |
| SMILES | CCOC(=O)CCCC1=CCC[C@@]23OC[C@@H](c4ccccc4)N2/C(=C/C(=O)OC)CC[C@@H]13 |
| InChI | InChI=1S/C26H33NO5/c1-3-31-24(28)13-7-11-19-12-8-16-26-22(19)15-14-21(17-25(29)30-2)27(26)23(18-32-26)20-9-5-4-6-10-20/h4-6,9-10,12,17,22-23H,3,7-8,11,13-16,18H2,1-2H3/b21-17+/t22-,23-,26-/m0/s1 |
| InChIKey | KGCXHYLQSPRUJZ-RTBQBIPKSA-N |
| XLogP | 4.68 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.55 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|