C20H29BO2 — CID 46703412
2-[6-(cyclohexen-1-yl)-2,3-dimethylphenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 46703412) has the molecular formula C20H29BO2 and a molecular weight of 312.26 g/mol. Its IUPAC name is 2-[6-(cyclohexen-1-yl)-2,3-dimethylphenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[6-(cyclohexen-1-yl)-2,3-dimethylphenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 46703412 |
| Molecular Formula | C20H29BO2 |
| Molecular Weight | 312.26 g/mol |
| Exact Mass | 312.23 |
| IUPAC Name | 2-[6-(cyclohexen-1-yl)-2,3-dimethylphenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | Cc1ccc(C2=CCCCC2)c(B2OC(C)(C)C(C)(C)O2)c1C |
| InChI | InChI=1S/C20H29BO2/c1-14-12-13-17(16-10-8-7-9-11-16)18(15(14)2)21-22-19(3,4)20(5,6)23-21/h10,12-13H,7-9,11H2,1-6H3 |
| InChIKey | RSBWKQIRTXLUOO-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.26 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|