C29H44O8 — CID 46703434
(2R,4R,5S,6S,10S,11S,12S)-2-(6-ethyl-3,5-dimethyl-4-oxopyran-2-yl)-5,11-dihydroxy-4,6,8,10,12-pentamethylpentadecane-3,7,9,13-tetrone (PubChem CID 46703434) has the molecular formula C29H44O8 and a molecular weight of 520.66 g/mol. Its IUPAC name is (2R,4R,5S,6S,10S,11S,12S)-2-(6-ethyl-3,5-dimethyl-4-oxopyran-2-yl)-5,11-dihydroxy-4,6,8,10,12-pentamethylpentadecane-3,7,9,13-tetrone.
| Compound Name | (2R,4R,5S,6S,10S,11S,12S)-2-(6-ethyl-3,5-dimethyl-4-oxopyran-2-yl)-5,11-dihydroxy-4,6,8,10,12-pentamethylpentadecane-3,7,9,13-tetrone |
|---|---|
| PubChem CID | 46703434 |
| Molecular Formula | C29H44O8 |
| Molecular Weight | 520.66 g/mol |
| Exact Mass | 520.30 |
| IUPAC Name | (2R,4R,5S,6S,10S,11S,12S)-2-(6-ethyl-3,5-dimethyl-4-oxopyran-2-yl)-5,11-dihydroxy-4,6,8,10,12-pentamethylpentadecane-3,7,9,13-tetrone |
| SMILES | CCC(=O)[C@@H](C)[C@H](O)[C@H](C)C(=O)C(C)C(=O)[C@@H](C)[C@@H](O)[C@@H](C)C(=O)[C@H](C)c1oc(CC)c(C)c(=O)c1C |
| InChI | InChI=1S/C29H44O8/c1-11-21(30)13(3)23(31)15(5)25(33)16(6)26(34)17(7)27(35)18(8)28(36)20(10)29-19(9)24(32)14(4)22(12-2)37-29/h13,15-18,20,23,27,31,35H,11-12H2,1-10H3/t13-,15+,16?,17-,18-,20+,23+,27-/m1/s1 |
| InChIKey | RJXNYZDLMKOERM-GFADUPKISA-N |
| XLogP | 3.51 |
| TPSA | 138.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.66 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|