About zinc bis((3E)-penta-1,3-diene)
zinc bis((3E)-penta-1,3-diene) (PubChem CID 46703737) has the molecular formula C10H14Zn
and a molecular weight of 199.61 g/mol. Its IUPAC name is zinc bis((3E)-penta-1,3-diene).
Molecular Properties
| Compound Name | zinc bis((3E)-penta-1,3-diene) |
| PubChem CID | 46703737 |
| Molecular Formula | C10H14Zn |
| Molecular Weight | 199.61 g/mol |
| Exact Mass | 198.04 |
| IUPAC Name | zinc bis((3E)-penta-1,3-diene) |
| SMILES | C=C/C=C/[CH2-].C=C/C=C/[CH2-].[Zn+2] |
| InChI | InChI=1S/2C5H7.Zn/c2*1-3-5-4-2;/h2*3-5H,1-2H2;/q2*-1;+2/b2*5-3+; |
| InChIKey | PWZVOLMYLIPQPH-MSEGBBJSSA-N |
| XLogP | 3.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.61 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze zinc bis((3E)-penta-1,3-diene) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of zinc bis((3E)-penta-1,3-diene)?
The IUPAC name of zinc bis((3E)-penta-1,3-diene) (CID 46703737) is zinc bis((3E)-penta-1,3-diene).
What is the SMILES notation for zinc bis((3E)-penta-1,3-diene)?
The canonical SMILES for zinc bis((3E)-penta-1,3-diene) is C=C/C=C/[CH2-].C=C/C=C/[CH2-].[Zn+2].
What is the InChIKey of zinc bis((3E)-penta-1,3-diene)?
The InChIKey is PWZVOLMYLIPQPH-MSEGBBJSSA-N. The full InChI is InChI=1S/2C5H7.Zn/c2*1-3-5-4-2;/h2*3-5H,1-2H2;/q2*-1;+2/b2*5-3+;.
What are the key properties of zinc bis((3E)-penta-1,3-diene)?
zinc bis((3E)-penta-1,3-diene) has a molecular weight of 199.61 g/mol, XLogP of 3.12, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for zinc bis((3E)-penta-1,3-diene) is sourced from PubChem (CID 46703737), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).