About 2-(Dodecylthio)-aniline
2-(Dodecylthio)-aniline (PubChem CID 4670379) has the molecular formula C18H31NS
and a molecular weight of 293.50 g/mol. Its IUPAC name is 2-dodecylsulfanylaniline.
Molecular Properties
| Compound Name | 2-(Dodecylthio)-aniline |
| PubChem CID | 4670379 |
| Molecular Formula | C18H31NS |
| Molecular Weight | 293.50 g/mol |
| Exact Mass | 293.22 |
| IUPAC Name | 2-dodecylsulfanylaniline |
| SMILES | CCCCCCCCCCCCSC1=CC=CC=C1N |
| InChI | InChI=1S/C18H31NS/c1-2-3-4-5-6-7-8-9-10-13-16-20-18-15-12-11-14-17(18)19/h11-12,14-15H,2-10,13,16,19H2,1H3 |
| InChIKey | GKGSIUUNOMZNFW-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 51.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | 208 |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 293.50 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-(Dodecylthio)-aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(Dodecylthio)-aniline?
The IUPAC name of 2-(Dodecylthio)-aniline (CID 4670379) is 2-dodecylsulfanylaniline.
What is the SMILES notation for 2-(Dodecylthio)-aniline?
The canonical SMILES for 2-(Dodecylthio)-aniline is CCCCCCCCCCCCSC1=CC=CC=C1N.
What is the InChIKey of 2-(Dodecylthio)-aniline?
The InChIKey is GKGSIUUNOMZNFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H31NS/c1-2-3-4-5-6-7-8-9-10-13-16-20-18-15-12-11-14-17(18)19/h11-12,14-15H,2-10,13,16,19H2,1H3.
What are the key properties of 2-(Dodecylthio)-aniline?
2-(Dodecylthio)-aniline has a molecular weight of 293.50 g/mol, XLogP of 7.30, 12 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(Dodecylthio)-aniline is sourced from PubChem (CID 4670379), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).