C11H16O4 — CID 46703883
[(3aR,4R,7aS)-2,2-dimethyl-3a,4,5,7a-tetrahydro-1,3-benzodioxol-4-yl] acetate (PubChem CID 46703883) has the molecular formula C11H16O4 and a molecular weight of 212.24 g/mol. Its IUPAC name is [(3aR,4R,7aS)-2,2-dimethyl-3a,4,5,7a-tetrahydro-1,3-benzodioxol-4-yl] acetate.
| Compound Name | [(3aR,4R,7aS)-2,2-dimethyl-3a,4,5,7a-tetrahydro-1,3-benzodioxol-4-yl] acetate |
|---|---|
| PubChem CID | 46703883 |
| Molecular Formula | C11H16O4 |
| Molecular Weight | 212.24 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | [(3aR,4R,7aS)-2,2-dimethyl-3a,4,5,7a-tetrahydro-1,3-benzodioxol-4-yl] acetate |
| SMILES | CC(=O)O[C@@H]1CC=C[C@@H]2OC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C11H16O4/c1-7(12)13-8-5-4-6-9-10(8)15-11(2,3)14-9/h4,6,8-10H,5H2,1-3H3/t8-,9+,10-/m1/s1 |
| InChIKey | GTLIHHQOUNXCGC-KXUCPTDWSA-N |
| XLogP | 1.40 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.24 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|