About 4-[(6-nitro-1,3-benzothiazol-2-yl)sulfanyl]pyridine-3-sulfonamide;hydrochloride
4-[(6-nitro-1,3-benzothiazol-2-yl)sulfanyl]pyridine-3-sulfonamide;hydrochloride (PubChem CID 46704246) has the molecular formula C12H9ClN4O4S3
and a molecular weight of 404.88 g/mol. Its IUPAC name is 4-[(6-nitro-1,3-benzothiazol-2-yl)sulfanyl]pyridine-3-sulfonamide;hydrochloride.
Molecular Properties
| Compound Name | 4-[(6-nitro-1,3-benzothiazol-2-yl)sulfanyl]pyridine-3-sulfonamide;hydrochloride |
| PubChem CID | 46704246 |
| Molecular Formula | C12H9ClN4O4S3 |
| Molecular Weight | 404.88 g/mol |
| Exact Mass | 403.95 |
| IUPAC Name | 4-[(6-nitro-1,3-benzothiazol-2-yl)sulfanyl]pyridine-3-sulfonamide;hydrochloride |
| SMILES | Cl.NS(=O)(=O)c1cnccc1Sc1nc2ccc([N+](=O)[O-])cc2s1 |
| InChI | InChI=1S/C12H8N4O4S3.ClH/c13-23(19,20)11-6-14-4-3-9(11)21-12-15-8-2-1-7(16(17)18)5-10(8)22-12;/h1-6H,(H2,13,19,20);1H |
| InChIKey | BVQQERDHVLGYGR-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 129.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 404.88 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-[(6-nitro-1,3-benzothiazol-2-yl)sulfanyl]pyridine-3-sulfonamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(6-nitro-1,3-benzothiazol-2-yl)sulfanyl]pyridine-3-sulfonamide;hydrochloride?
The IUPAC name of 4-[(6-nitro-1,3-benzothiazol-2-yl)sulfanyl]pyridine-3-sulfonamide;hydrochloride (CID 46704246) is 4-[(6-nitro-1,3-benzothiazol-2-yl)sulfanyl]pyridine-3-sulfonamide;hydrochloride.
What is the SMILES notation for 4-[(6-nitro-1,3-benzothiazol-2-yl)sulfanyl]pyridine-3-sulfonamide;hydrochloride?
The canonical SMILES for 4-[(6-nitro-1,3-benzothiazol-2-yl)sulfanyl]pyridine-3-sulfonamide;hydrochloride is Cl.NS(=O)(=O)c1cnccc1Sc1nc2ccc([N+](=O)[O-])cc2s1.
What is the InChIKey of 4-[(6-nitro-1,3-benzothiazol-2-yl)sulfanyl]pyridine-3-sulfonamide;hydrochloride?
The InChIKey is BVQQERDHVLGYGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8N4O4S3.ClH/c13-23(19,20)11-6-14-4-3-9(11)21-12-15-8-2-1-7(16(17)18)5-10(8)22-12;/h1-6H,(H2,13,19,20);1H.
What are the key properties of 4-[(6-nitro-1,3-benzothiazol-2-yl)sulfanyl]pyridine-3-sulfonamide;hydrochloride?
4-[(6-nitro-1,3-benzothiazol-2-yl)sulfanyl]pyridine-3-sulfonamide;hydrochloride has a molecular weight of 404.88 g/mol, XLogP of 2.82, 4 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(6-nitro-1,3-benzothiazol-2-yl)sulfanyl]pyridine-3-sulfonamide;hydrochloride is sourced from PubChem (CID 46704246), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).