C17H20O7 — CID 46704283
[5-(hydroxymethyl)-6-[(E)-3-hydroxyprop-1-enyl]-4-methoxy-2-oxopyran-3-yl]methyl (2Z,4E)-hexa-2,4-dienoate (PubChem CID 46704283) has the molecular formula C17H20O7 and a molecular weight of 336.34 g/mol. Its IUPAC name is [5-(hydroxymethyl)-6-[(E)-3-hydroxyprop-1-enyl]-4-methoxy-2-oxopyran-3-yl]methyl (2Z,4E)-hexa-2,4-dienoate.
| Compound Name | [5-(hydroxymethyl)-6-[(E)-3-hydroxyprop-1-enyl]-4-methoxy-2-oxopyran-3-yl]methyl (2Z,4E)-hexa-2,4-dienoate |
|---|---|
| PubChem CID | 46704283 |
| Molecular Formula | C17H20O7 |
| Molecular Weight | 336.34 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | [5-(hydroxymethyl)-6-[(E)-3-hydroxyprop-1-enyl]-4-methoxy-2-oxopyran-3-yl]methyl (2Z,4E)-hexa-2,4-dienoate |
| SMILES | C/C=C/C=C\C(=O)OCc1c(OC)c(CO)c(/C=C/CO)oc1=O |
| InChI | InChI=1S/C17H20O7/c1-3-4-5-8-15(20)23-11-13-16(22-2)12(10-19)14(7-6-9-18)24-17(13)21/h3-8,18-19H,9-11H2,1-2H3/b4-3+,7-6+,8-5- |
| InChIKey | UOMAGVHZSLPVJJ-RLBCQOATSA-N |
| XLogP | 1.32 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.34 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|