C21H18ClNO6 — CID 4670474
[5-(2-chloro-5-nitrophenyl)furan-2-yl]methyl 2-(2,4-dimethylphenoxy)acetate (PubChem CID 4670474) has the molecular formula C21H18ClNO6 and a molecular weight of 415.83 g/mol. Its IUPAC name is [5-(2-chloro-5-nitrophenyl)furan-2-yl]methyl 2-(2,4-dimethylphenoxy)acetate.
| Compound Name | [5-(2-chloro-5-nitrophenyl)furan-2-yl]methyl 2-(2,4-dimethylphenoxy)acetate |
|---|---|
| PubChem CID | 4670474 |
| Molecular Formula | C21H18ClNO6 |
| Molecular Weight | 415.83 g/mol |
| Exact Mass | 415.08 |
| IUPAC Name | [5-(2-chloro-5-nitrophenyl)furan-2-yl]methyl 2-(2,4-dimethylphenoxy)acetate |
| SMILES | Cc1ccc(OCC(=O)OCc2ccc(-c3cc([N+](=O)[O-])ccc3Cl)o2)c(C)c1 |
| InChI | InChI=1S/C21H18ClNO6/c1-13-3-7-19(14(2)9-13)27-12-21(24)28-11-16-5-8-20(29-16)17-10-15(23(25)26)4-6-18(17)22/h3-10H,11-12H2,1-2H3 |
| InChIKey | PSIIHGZGYVJXCJ-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 91.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.83 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|