About 4-chloropyrido[1,2-a]pyrimidin-2-one
4-chloropyrido[1,2-a]pyrimidin-2-one (PubChem CID 46707323) has the molecular formula C8H5ClN2O
and a molecular weight of 180.59 g/mol. Its IUPAC name is 4-chloropyrido[1,2-a]pyrimidin-2-one.
Molecular Properties
| Compound Name | 4-chloropyrido[1,2-a]pyrimidin-2-one |
| PubChem CID | 46707323 |
| Molecular Formula | C8H5ClN2O |
| Molecular Weight | 180.59 g/mol |
| Exact Mass | 180.01 |
| IUPAC Name | 4-chloropyrido[1,2-a]pyrimidin-2-one |
| SMILES | O=c1cc(Cl)n2ccccc2n1 |
| InChI | InChI=1S/C8H5ClN2O/c9-6-5-8(12)10-7-3-1-2-4-11(6)7/h1-5H |
| InChIKey | KDTOCGKNENHIDU-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 34.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.59 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-chloropyrido[1,2-a]pyrimidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloropyrido[1,2-a]pyrimidin-2-one?
The IUPAC name of 4-chloropyrido[1,2-a]pyrimidin-2-one (CID 46707323) is 4-chloropyrido[1,2-a]pyrimidin-2-one.
What is the SMILES notation for 4-chloropyrido[1,2-a]pyrimidin-2-one?
The canonical SMILES for 4-chloropyrido[1,2-a]pyrimidin-2-one is O=c1cc(Cl)n2ccccc2n1.
What is the InChIKey of 4-chloropyrido[1,2-a]pyrimidin-2-one?
The InChIKey is KDTOCGKNENHIDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5ClN2O/c9-6-5-8(12)10-7-3-1-2-4-11(6)7/h1-5H.
What are the key properties of 4-chloropyrido[1,2-a]pyrimidin-2-one?
4-chloropyrido[1,2-a]pyrimidin-2-one has a molecular weight of 180.59 g/mol, XLogP of 1.35, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloropyrido[1,2-a]pyrimidin-2-one is sourced from PubChem (CID 46707323), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).