About ethyl N-[(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methylideneamino]carbamate
ethyl N-[(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methylideneamino]carbamate (PubChem CID 4671305) has the molecular formula C13H20N2O2
and a molecular weight of 236.31 g/mol. Its IUPAC name is ethyl N-[(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methylideneamino]carbamate.
Molecular Properties
| Compound Name | ethyl N-[(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methylideneamino]carbamate |
| PubChem CID | 4671305 |
| Molecular Formula | C13H20N2O2 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.15 |
| IUPAC Name | ethyl N-[(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methylideneamino]carbamate |
| SMILES | CCOC(=O)NN=CC1=CCC2CC1C2(C)C |
| InChI | InChI=1S/C13H20N2O2/c1-4-17-12(16)15-14-8-9-5-6-10-7-11(9)13(10,2)3/h5,8,10-11H,4,6-7H2,1-3H3,(H,15,16) |
| InChIKey | GCRFUQYZTSOAHV-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethyl N-[(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methylideneamino]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl N-[(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methylideneamino]carbamate?
The IUPAC name of ethyl N-[(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methylideneamino]carbamate (CID 4671305) is ethyl N-[(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methylideneamino]carbamate.
What is the SMILES notation for ethyl N-[(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methylideneamino]carbamate?
The canonical SMILES for ethyl N-[(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methylideneamino]carbamate is CCOC(=O)NN=CC1=CCC2CC1C2(C)C.
What is the InChIKey of ethyl N-[(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methylideneamino]carbamate?
The InChIKey is GCRFUQYZTSOAHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N2O2/c1-4-17-12(16)15-14-8-9-5-6-10-7-11(9)13(10,2)3/h5,8,10-11H,4,6-7H2,1-3H3,(H,15,16).
What are the key properties of ethyl N-[(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methylideneamino]carbamate?
ethyl N-[(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methylideneamino]carbamate has a molecular weight of 236.31 g/mol, XLogP of 2.71, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl N-[(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methylideneamino]carbamate is sourced from PubChem (CID 4671305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).