C25H21ClN2O7S — CID 4671636
4-[3-[(4-chlorophenyl)-hydroxymethylidene]-2-(2,4-dimethoxyphenyl)-4,5-dioxopyrrolidin-1-yl]benzenesulfonamide (PubChem CID 4671636) has the molecular formula C25H21ClN2O7S and a molecular weight of 528.97 g/mol. Its IUPAC name is 4-[3-[(4-chlorophenyl)-hydroxymethylidene]-2-(2,4-dimethoxyphenyl)-4,5-dioxopyrrolidin-1-yl]benzenesulfonamide.
| Compound Name | 4-[3-[(4-chlorophenyl)-hydroxymethylidene]-2-(2,4-dimethoxyphenyl)-4,5-dioxopyrrolidin-1-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 4671636 |
| Molecular Formula | C25H21ClN2O7S |
| Molecular Weight | 528.97 g/mol |
| Exact Mass | 528.08 |
| IUPAC Name | 4-[3-[(4-chlorophenyl)-hydroxymethylidene]-2-(2,4-dimethoxyphenyl)-4,5-dioxopyrrolidin-1-yl]benzenesulfonamide |
| SMILES | COc1ccc(C2C(=C(O)c3ccc(Cl)cc3)C(=O)C(=O)N2c2ccc(S(N)(=O)=O)cc2)c(OC)c1 |
| InChI | InChI=1S/C25H21ClN2O7S/c1-34-17-9-12-19(20(13-17)35-2)22-21(23(29)14-3-5-15(26)6-4-14)24(30)25(31)28(22)16-7-10-18(11-8-16)36(27,32)33/h3-13,22,29H,1-2H3,(H2,27,32,33) |
| InChIKey | GPJOIJUEJFZFRN-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 136.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.97 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|