About 6-bromo-2,3-dimethoxybenzaldehyde
6-bromo-2,3-dimethoxybenzaldehyde (PubChem CID 4671952) has the molecular formula C9H9BrO3
and a molecular weight of 245.07 g/mol. Its IUPAC name is 6-bromo-2,3-dimethoxybenzaldehyde.
Molecular Properties
| Compound Name | 6-bromo-2,3-dimethoxybenzaldehyde |
| PubChem CID | 4671952 |
| Molecular Formula | C9H9BrO3 |
| Molecular Weight | 245.07 g/mol |
| Exact Mass | 243.97 |
| IUPAC Name | 6-bromo-2,3-dimethoxybenzaldehyde |
| SMILES | COc1ccc(Br)c(C=O)c1OC |
| InChI | InChI=1S/C9H9BrO3/c1-12-8-4-3-7(10)6(5-11)9(8)13-2/h3-5H,1-2H3 |
| InChIKey | BXASBZFXGUZRDR-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.07 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 6-bromo-2,3-dimethoxybenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-2,3-dimethoxybenzaldehyde?
The IUPAC name of 6-bromo-2,3-dimethoxybenzaldehyde (CID 4671952) is 6-bromo-2,3-dimethoxybenzaldehyde.
What is the SMILES notation for 6-bromo-2,3-dimethoxybenzaldehyde?
The canonical SMILES for 6-bromo-2,3-dimethoxybenzaldehyde is COc1ccc(Br)c(C=O)c1OC.
What is the InChIKey of 6-bromo-2,3-dimethoxybenzaldehyde?
The InChIKey is BXASBZFXGUZRDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9BrO3/c1-12-8-4-3-7(10)6(5-11)9(8)13-2/h3-5H,1-2H3.
What are the key properties of 6-bromo-2,3-dimethoxybenzaldehyde?
6-bromo-2,3-dimethoxybenzaldehyde has a molecular weight of 245.07 g/mol, XLogP of 2.28, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-2,3-dimethoxybenzaldehyde is sourced from PubChem (CID 4671952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).