2,1,3-benzoxadiazol-5-ylboronic acid

C6H5BN2O3 — CID 4672597

IUPAC2,1,3-benzoxadiazol-5-ylboronic acid
SMILESOB(O)c1ccc2nonc2c1
InChIInChI=1S/C6H5BN2O3/c10-7(11)4-1-2-5-6(3-4)9-12-8-5/h1-3,10-11H
InChIKeyCHYMBQMSEFLESI-UHFFFAOYSA-N
MW163.93 g/mol
LogP-1.10
Rot. Bonds1

About 2,1,3-benzoxadiazol-5-ylboronic acid

2,1,3-benzoxadiazol-5-ylboronic acid (PubChem CID 4672597) has the molecular formula C6H5BN2O3 and a molecular weight of 163.93 g/mol. Its IUPAC name is 2,1,3-benzoxadiazol-5-ylboronic acid.

Molecular Properties

Compound Name2,1,3-benzoxadiazol-5-ylboronic acid
PubChem CID4672597
Molecular FormulaC6H5BN2O3
Molecular Weight163.93 g/mol
Exact Mass164.04
IUPAC Name2,1,3-benzoxadiazol-5-ylboronic acid
SMILESOB(O)c1ccc2nonc2c1
InChIInChI=1S/C6H5BN2O3/c10-7(11)4-1-2-5-6(3-4)9-12-8-5/h1-3,10-11H
InChIKeyCHYMBQMSEFLESI-UHFFFAOYSA-N
XLogP-1.10
TPSA79.38 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds1
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500163.93
LogP ≤ 5-1.10
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze 2,1,3-benzoxadiazol-5-ylboronic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,1,3-benzoxadiazol-5-ylboronic acid?
The IUPAC name of 2,1,3-benzoxadiazol-5-ylboronic acid (CID 4672597) is 2,1,3-benzoxadiazol-5-ylboronic acid.
What is the SMILES notation for 2,1,3-benzoxadiazol-5-ylboronic acid?
The canonical SMILES for 2,1,3-benzoxadiazol-5-ylboronic acid is OB(O)c1ccc2nonc2c1.
What is the InChIKey of 2,1,3-benzoxadiazol-5-ylboronic acid?
The InChIKey is CHYMBQMSEFLESI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5BN2O3/c10-7(11)4-1-2-5-6(3-4)9-12-8-5/h1-3,10-11H.
What are the key properties of 2,1,3-benzoxadiazol-5-ylboronic acid?
2,1,3-benzoxadiazol-5-ylboronic acid has a molecular weight of 163.93 g/mol, XLogP of -1.10, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,1,3-benzoxadiazol-5-ylboronic acid is sourced from PubChem (CID 4672597), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).