C11H5F3N8O — CID 4673250
N-[3-(trifluoromethyl)phenyl]-4-oxa-1,3,5,7,10,11,12-heptazatricyclo[7.3.0.02,6]dodeca-2,5,7,9,11-pentaen-8-amine (PubChem CID 4673250) has the molecular formula C11H5F3N8O and a molecular weight of 322.21 g/mol. Its IUPAC name is N-[3-(trifluoromethyl)phenyl]-4-oxa-1,3,5,7,10,11,12-heptazatricyclo[7.3.0.02,6]dodeca-2,5,7,9,11-pentaen-8-amine.
| Compound Name | N-[3-(trifluoromethyl)phenyl]-4-oxa-1,3,5,7,10,11,12-heptazatricyclo[7.3.0.02,6]dodeca-2,5,7,9,11-pentaen-8-amine |
|---|---|
| PubChem CID | 4673250 |
| Molecular Formula | C11H5F3N8O |
| Molecular Weight | 322.21 g/mol |
| Exact Mass | 322.05 |
| IUPAC Name | N-[3-(trifluoromethyl)phenyl]-4-oxa-1,3,5,7,10,11,12-heptazatricyclo[7.3.0.02,6]dodeca-2,5,7,9,11-pentaen-8-amine |
| SMILES | FC(F)(F)c1cccc(Nc2nc3nonc3n3nnnc23)c1 |
| InChI | InChI=1S/C11H5F3N8O/c12-11(13,14)5-2-1-3-6(4-5)15-7-9-17-20-21-22(9)10-8(16-7)18-23-19-10/h1-4H,(H,15,16,18) |
| InChIKey | MXRJMUHHGCUOFN-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 106.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.21 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |