C8H18F3NO2Si — CID 46735245
3-[methyl-bis(trideuteriomethyl)silyl]propan-1-amine;2,2,2-trifluoroacetic acid (PubChem CID 46735245) has the molecular formula C8H18F3NO2Si and a molecular weight of 251.35 g/mol. Its IUPAC name is 3-[methyl-bis(trideuteriomethyl)silyl]propan-1-amine;2,2,2-trifluoroacetic acid.
| Compound Name | 3-[methyl-bis(trideuteriomethyl)silyl]propan-1-amine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 46735245 |
| Molecular Formula | C8H18F3NO2Si |
| Molecular Weight | 251.35 g/mol |
| Exact Mass | 251.14 |
| IUPAC Name | 3-[methyl-bis(trideuteriomethyl)silyl]propan-1-amine;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.[2H]C([2H])([2H])[Si](C)(CCCN)C([2H])([2H])[2H] |
| InChI | InChI=1S/C6H17NSi.C2HF3O2/c1-8(2,3)6-4-5-7;3-2(4,5)1(6)7/h4-7H2,1-3H3;(H,6,7)/i1D3,2D3; |
| InChIKey | JXDWYTGWUFJQNX-TXHXQZCNSA-N |
| XLogP | 2.31 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.35 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|